C19H36O2 — CID 67248609
12,12,13,13,14,14-hexamethyl-oxacyclotetradecan-3-one (PubChem CID 67248609) has the molecular formula C19H36O2 and a molecular weight of 296.50 g/mol. Its IUPAC name is 12,12,13,13,14,14-hexamethyl-oxacyclotetradecan-3-one.
| Compound Name | 12,12,13,13,14,14-hexamethyl-oxacyclotetradecan-3-one |
|---|---|
| PubChem CID | 67248609 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | 12,12,13,13,14,14-hexamethyl-oxacyclotetradecan-3-one |
| SMILES | CC1(C)CCCCCCCCC(=O)COC(C)(C)C1(C)C |
| InChI | InChI=1S/C19H36O2/c1-17(2)14-12-10-8-7-9-11-13-16(20)15-21-19(5,6)18(17,3)4/h7-15H2,1-6H3 |
| InChIKey | XDDSJMSRYDSFDJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |