C30H41FN2O2 — CID 6724870
(3S,9S,10R,13S,14S,17S)-17-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 6724870) has the molecular formula C30H41FN2O2 and a molecular weight of 480.67 g/mol. Its IUPAC name is (3S,9S,10R,13S,14S,17S)-17-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (3S,9S,10R,13S,14S,17S)-17-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 6724870 |
| Molecular Formula | C30H41FN2O2 |
| Molecular Weight | 480.67 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | (3S,9S,10R,13S,14S,17S)-17-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@H](O)CC1=CC=C1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)CN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C30H41FN2O2/c1-28-12-9-24(34)19-21(28)3-8-25-26(28)10-13-29(2)27(25)11-14-30(29,35)20-32-15-17-33(18-16-32)23-6-4-22(31)5-7-23/h3-8,24,26-27,34-35H,9-20H2,1-2H3/t24-,26-,27-,28-,29-,30+/m0/s1 |
| InChIKey | RHENZJYWEZXUQX-UJJOWMEUSA-N |
| XLogP | 4.92 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.67 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |