C21H25N5O2S — CID 67248747
1-[5-[3-methyl-5-[[4-[2-(methylamino)ethoxy]pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]cyclobutan-1-ol (PubChem CID 67248747) has the molecular formula C21H25N5O2S and a molecular weight of 411.53 g/mol. Its IUPAC name is 1-[5-[3-methyl-5-[[4-[2-(methylamino)ethoxy]pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]cyclobutan-1-ol.
| Compound Name | 1-[5-[3-methyl-5-[[4-[2-(methylamino)ethoxy]pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 67248747 |
| Molecular Formula | C21H25N5O2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 1-[5-[3-methyl-5-[[4-[2-(methylamino)ethoxy]pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]cyclobutan-1-ol |
| SMILES | CNCCOc1ccnc(Nc2cc(C)cc(-c3cnc(C4(O)CCC4)s3)c2)n1 |
| InChI | InChI=1S/C21H25N5O2S/c1-14-10-15(17-13-24-19(29-17)21(27)5-3-6-21)12-16(11-14)25-20-23-7-4-18(26-20)28-9-8-22-2/h4,7,10-13,22,27H,3,5-6,8-9H2,1-2H3,(H,23,25,26) |
| InChIKey | QPCIUECKBINGTQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|