About [4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexyl]methanol
[4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexyl]methanol (PubChem CID 67248875) has the molecular formula C11H19F3OS
and a molecular weight of 256.33 g/mol. Its IUPAC name is [4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexyl]methanol.
Molecular Properties
| Compound Name | [4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexyl]methanol |
| PubChem CID | 67248875 |
| Molecular Formula | C11H19F3OS |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | [4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexyl]methanol |
| SMILES | OCC1CCC(CSCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H19F3OS/c12-11(13,14)5-6-16-8-10-3-1-9(7-15)2-4-10/h9-10,15H,1-8H2 |
| InChIKey | GHJDGAVRTIMJAZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexyl]methanol?
The IUPAC name of [4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexyl]methanol (CID 67248875) is [4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexyl]methanol.
What is the SMILES notation for [4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexyl]methanol?
The canonical SMILES for [4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexyl]methanol is OCC1CCC(CSCCC(F)(F)F)CC1.
What is the InChIKey of [4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexyl]methanol?
The InChIKey is GHJDGAVRTIMJAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3OS/c12-11(13,14)5-6-16-8-10-3-1-9(7-15)2-4-10/h9-10,15H,1-8H2.
What are the key properties of [4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexyl]methanol?
[4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexyl]methanol has a molecular weight of 256.33 g/mol, XLogP of 3.47, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexyl]methanol is sourced from PubChem (CID 67248875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).