C28H46N2O4 — CID 6724897
1-[[(3S,9S,10R,13S,14S,17S)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]methyl]-1-(3-methoxypropyl)-3-propan-2-ylurea (PubChem CID 6724897) has the molecular formula C28H46N2O4 and a molecular weight of 474.69 g/mol. Its IUPAC name is 1-[[(3S,9S,10R,13S,14S,17S)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]methyl]-1-(3-methoxypropyl)-3-propan-2-ylurea.
| Compound Name | 1-[[(3S,9S,10R,13S,14S,17S)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]methyl]-1-(3-methoxypropyl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 6724897 |
| Molecular Formula | C28H46N2O4 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.35 |
| IUPAC Name | 1-[[(3S,9S,10R,13S,14S,17S)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]methyl]-1-(3-methoxypropyl)-3-propan-2-ylurea |
| SMILES | COCCCN(C[C@]1(O)CC[C@H]2C3=CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C)C(=O)NC(C)C |
| InChI | InChI=1S/C28H46N2O4/c1-19(2)29-25(32)30(15-6-16-34-5)18-28(33)14-11-24-22-8-7-20-17-21(31)9-12-26(20,3)23(22)10-13-27(24,28)4/h7-8,19,21,23-24,31,33H,6,9-18H2,1-5H3,(H,29,32)/t21-,23-,24-,26-,27-,28+/m0/s1 |
| InChIKey | XMDHMZQBVVSBBX-KVFJRNHVSA-N |
| XLogP | 4.42 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|