C31H36N4O2 — CID 67249888
(3S,4S)-3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione;N-ethylcyclohexanamine (PubChem CID 67249888) has the molecular formula C31H36N4O2 and a molecular weight of 496.66 g/mol. Its IUPAC name is (3S,4S)-3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione;N-ethylcyclohexanamine.
| Compound Name | (3S,4S)-3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione;N-ethylcyclohexanamine |
|---|---|
| PubChem CID | 67249888 |
| Molecular Formula | C31H36N4O2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | (3S,4S)-3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione;N-ethylcyclohexanamine |
| SMILES | CCNC1CCCCC1.O=C1NC(=O)[C@H](c2cn3c4c(cccc24)CCC3)[C@H]1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H19N3O2.C8H17N/c27-22-19(16-11-24-18-9-2-1-7-14(16)18)20(23(28)25-22)17-12-26-10-4-6-13-5-3-8-15(17)21(13)26;1-2-9-8-6-4-3-5-7-8/h1-3,5,7-9,11-12,19-20,24H,4,6,10H2,(H,25,27,28);8-9H,2-7H2,1H3/t19-,20-;/m1./s1 |
| InChIKey | IEUUOWDQGFUXCX-GZJHNZOKSA-N |
| XLogP | 5.52 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|