About tert-butyl 2-(6-phenylmethoxy-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl)acetate
tert-butyl 2-(6-phenylmethoxy-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl)acetate (PubChem CID 67250144) has the molecular formula C24H27NO3
and a molecular weight of 377.48 g/mol. Its IUPAC name is tert-butyl 2-(6-phenylmethoxy-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl)acetate.
Molecular Properties
| Compound Name | tert-butyl 2-(6-phenylmethoxy-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl)acetate |
| PubChem CID | 67250144 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | tert-butyl 2-(6-phenylmethoxy-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CC1CCn2c1cc1cc(OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C24H27NO3/c1-24(2,3)28-23(26)15-18-11-12-25-21-10-9-20(13-19(21)14-22(18)25)27-16-17-7-5-4-6-8-17/h4-10,13-14,18H,11-12,15-16H2,1-3H3 |
| InChIKey | NZCINCUYJNEEPZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 2-(6-phenylmethoxy-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(6-phenylmethoxy-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl)acetate?
The IUPAC name of tert-butyl 2-(6-phenylmethoxy-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl)acetate (CID 67250144) is tert-butyl 2-(6-phenylmethoxy-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl)acetate.
What is the SMILES notation for tert-butyl 2-(6-phenylmethoxy-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl)acetate?
The canonical SMILES for tert-butyl 2-(6-phenylmethoxy-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl)acetate is CC(C)(C)OC(=O)CC1CCn2c1cc1cc(OCc3ccccc3)ccc12.
What is the InChIKey of tert-butyl 2-(6-phenylmethoxy-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl)acetate?
The InChIKey is NZCINCUYJNEEPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27NO3/c1-24(2,3)28-23(26)15-18-11-12-25-21-10-9-20(13-19(21)14-22(18)25)27-16-17-7-5-4-6-8-17/h4-10,13-14,18H,11-12,15-16H2,1-3H3.
What are the key properties of tert-butyl 2-(6-phenylmethoxy-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl)acetate?
tert-butyl 2-(6-phenylmethoxy-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl)acetate has a molecular weight of 377.48 g/mol, XLogP of 5.44, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(6-phenylmethoxy-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl)acetate is sourced from PubChem (CID 67250144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).