C19H22N2O — CID 67250237
(4aS)-10-(4-methylphenyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[2,1-d][1,5]benzoxazepine (PubChem CID 67250237) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is (4aS)-10-(4-methylphenyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[2,1-d][1,5]benzoxazepine.
| Compound Name | (4aS)-10-(4-methylphenyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[2,1-d][1,5]benzoxazepine |
|---|---|
| PubChem CID | 67250237 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (4aS)-10-(4-methylphenyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[2,1-d][1,5]benzoxazepine |
| SMILES | Cc1ccc(-c2ccc3c(c2)N2CCNC[C@@H]2CCO3)cc1 |
| InChI | InChI=1S/C19H22N2O/c1-14-2-4-15(5-3-14)16-6-7-19-18(12-16)21-10-9-20-13-17(21)8-11-22-19/h2-7,12,17,20H,8-11,13H2,1H3/t17-/m0/s1 |
| InChIKey | JRJNKTNLEWRDRU-KRWDZBQOSA-N |
| XLogP | 3.22 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |