C29H36N2O3S — CID 67250246
1-[3-amino-4-methoxy-2-[[4-[2-(2-methylsulfanylethylamino)ethoxy]phenyl]methyl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 67250246) has the molecular formula C29H36N2O3S and a molecular weight of 492.69 g/mol. Its IUPAC name is 1-[3-amino-4-methoxy-2-[[4-[2-(2-methylsulfanylethylamino)ethoxy]phenyl]methyl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 1-[3-amino-4-methoxy-2-[[4-[2-(2-methylsulfanylethylamino)ethoxy]phenyl]methyl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 67250246 |
| Molecular Formula | C29H36N2O3S |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 1-[3-amino-4-methoxy-2-[[4-[2-(2-methylsulfanylethylamino)ethoxy]phenyl]methyl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | COc1ccc(-c2c(O)ccc3c2CCCC3)c(Cc2ccc(OCCNCCSC)cc2)c1N |
| InChI | InChI=1S/C29H36N2O3S/c1-33-27-14-12-24(28-23-6-4-3-5-21(23)9-13-26(28)32)25(29(27)30)19-20-7-10-22(11-8-20)34-17-15-31-16-18-35-2/h7-14,31-32H,3-6,15-19,30H2,1-2H3 |
| InChIKey | MPPRCFSJEVAXDK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|