About 1H-benzimidazol-3-ium;2,2,2-trifluoroacetate
1H-benzimidazol-3-ium;2,2,2-trifluoroacetate (PubChem CID 67250353) has the molecular formula C9H7F3N2O2
and a molecular weight of 232.16 g/mol. Its IUPAC name is 1H-benzimidazol-3-ium;2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 1H-benzimidazol-3-ium;2,2,2-trifluoroacetate |
| PubChem CID | 67250353 |
| Molecular Formula | C9H7F3N2O2 |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 1H-benzimidazol-3-ium;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.c1ccc2[nH+]c[nH]c2c1 |
| InChI | InChI=1S/C7H6N2.C2HF3O2/c1-2-4-7-6(3-1)8-5-9-7;3-2(4,5)1(6)7/h1-5H,(H,8,9);(H,6,7) |
| InChIKey | JLTBOEOEGVJJCU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-benzimidazol-3-ium;2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazol-3-ium;2,2,2-trifluoroacetate?
The IUPAC name of 1H-benzimidazol-3-ium;2,2,2-trifluoroacetate (CID 67250353) is 1H-benzimidazol-3-ium;2,2,2-trifluoroacetate.
What is the SMILES notation for 1H-benzimidazol-3-ium;2,2,2-trifluoroacetate?
The canonical SMILES for 1H-benzimidazol-3-ium;2,2,2-trifluoroacetate is O=C([O-])C(F)(F)F.c1ccc2[nH+]c[nH]c2c1.
What is the InChIKey of 1H-benzimidazol-3-ium;2,2,2-trifluoroacetate?
The InChIKey is JLTBOEOEGVJJCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C2HF3O2/c1-2-4-7-6(3-1)8-5-9-7;3-2(4,5)1(6)7/h1-5H,(H,8,9);(H,6,7).
What are the key properties of 1H-benzimidazol-3-ium;2,2,2-trifluoroacetate?
1H-benzimidazol-3-ium;2,2,2-trifluoroacetate has a molecular weight of 232.16 g/mol, XLogP of 0.28, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazol-3-ium;2,2,2-trifluoroacetate is sourced from PubChem (CID 67250353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).