About N-[(5R)-4,6-dioxo-2-(2-oxo-2-piperidin-1-ylethyl)sulfanyl-1H-pyrimidin-5-yl]acetamide
N-[(5R)-4,6-dioxo-2-(2-oxo-2-piperidin-1-ylethyl)sulfanyl-1H-pyrimidin-5-yl]acetamide (PubChem CID 672507) has the molecular formula C13H18N4O4S
and a molecular weight of 326.38 g/mol. Its IUPAC name is N-[(5R)-4,6-dioxo-2-(2-oxo-2-piperidin-1-ylethyl)sulfanyl-1H-pyrimidin-5-yl]acetamide.
Molecular Properties
| Compound Name | N-[(5R)-4,6-dioxo-2-(2-oxo-2-piperidin-1-ylethyl)sulfanyl-1H-pyrimidin-5-yl]acetamide |
| PubChem CID | 672507 |
| Molecular Formula | C13H18N4O4S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-[(5R)-4,6-dioxo-2-(2-oxo-2-piperidin-1-ylethyl)sulfanyl-1H-pyrimidin-5-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C(=O)N=C(SCC(=O)N2CCCCC2)NC1=O |
| InChI | InChI=1S/C13H18N4O4S/c1-8(18)14-10-11(20)15-13(16-12(10)21)22-7-9(19)17-5-3-2-4-6-17/h10H,2-7H2,1H3,(H,14,18)(H,15,16,20,21) |
| InChIKey | WORHSIIWRPZQRV-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-[(5R)-4,6-dioxo-2-(2-oxo-2-piperidin-1-ylethyl)sulfanyl-1H-pyrimidin-5-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5R)-4,6-dioxo-2-(2-oxo-2-piperidin-1-ylethyl)sulfanyl-1H-pyrimidin-5-yl]acetamide?
The IUPAC name of N-[(5R)-4,6-dioxo-2-(2-oxo-2-piperidin-1-ylethyl)sulfanyl-1H-pyrimidin-5-yl]acetamide (CID 672507) is N-[(5R)-4,6-dioxo-2-(2-oxo-2-piperidin-1-ylethyl)sulfanyl-1H-pyrimidin-5-yl]acetamide.
What is the SMILES notation for N-[(5R)-4,6-dioxo-2-(2-oxo-2-piperidin-1-ylethyl)sulfanyl-1H-pyrimidin-5-yl]acetamide?
The canonical SMILES for N-[(5R)-4,6-dioxo-2-(2-oxo-2-piperidin-1-ylethyl)sulfanyl-1H-pyrimidin-5-yl]acetamide is CC(=O)N[C@H]1C(=O)N=C(SCC(=O)N2CCCCC2)NC1=O.
What is the InChIKey of N-[(5R)-4,6-dioxo-2-(2-oxo-2-piperidin-1-ylethyl)sulfanyl-1H-pyrimidin-5-yl]acetamide?
The InChIKey is WORHSIIWRPZQRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O4S/c1-8(18)14-10-11(20)15-13(16-12(10)21)22-7-9(19)17-5-3-2-4-6-17/h10H,2-7H2,1H3,(H,14,18)(H,15,16,20,21).
What are the key properties of N-[(5R)-4,6-dioxo-2-(2-oxo-2-piperidin-1-ylethyl)sulfanyl-1H-pyrimidin-5-yl]acetamide?
N-[(5R)-4,6-dioxo-2-(2-oxo-2-piperidin-1-ylethyl)sulfanyl-1H-pyrimidin-5-yl]acetamide has a molecular weight of 326.38 g/mol, XLogP of -0.75, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5R)-4,6-dioxo-2-(2-oxo-2-piperidin-1-ylethyl)sulfanyl-1H-pyrimidin-5-yl]acetamide is sourced from PubChem (CID 672507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).