C32H49NO4 — CID 6725099
cyclohexyl-[(1R,2S,5S,6S,9R,10R,15R)-5,13-dihydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 6725099) has the molecular formula C32H49NO4 and a molecular weight of 511.75 g/mol. Its IUPAC name is cyclohexyl-[(1R,2S,5S,6S,9R,10R,15R)-5,13-dihydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | cyclohexyl-[(1R,2S,5S,6S,9R,10R,15R)-5,13-dihydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 6725099 |
| Molecular Formula | C32H49NO4 |
| Molecular Weight | 511.75 g/mol |
| Exact Mass | 511.37 |
| IUPAC Name | cyclohexyl-[(1R,2S,5S,6S,9R,10R,15R)-5,13-dihydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | CN(CCO)C[C@]1(O)CC[C@H]2[C@]34C=C[C@@]5(C=C3C(=O)C3CCCCC3)CC(O)CC[C@]5(C)[C@H]4CC[C@@]21C |
| InChI | InChI=1S/C32H49NO4/c1-28-12-9-23(35)19-30(28)15-16-32(24(20-30)27(36)22-7-5-4-6-8-22)25(28)10-13-29(2)26(32)11-14-31(29,37)21-33(3)17-18-34/h15-16,20,22-23,25-26,34-35,37H,4-14,17-19,21H2,1-3H3/t23?,25-,26-,28-,29+,30+,31-,32-/m1/s1 |
| InChIKey | OSXQAUJPYXWNQF-FRTFASAYSA-N |
| XLogP | 4.65 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.75 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|