About 1H-pyrazolo[5,4-b]pyridine-6-carboxylic acid
1H-pyrazolo[5,4-b]pyridine-6-carboxylic acid (PubChem CID 67251082) has the molecular formula C7H5N3O2
and a molecular weight of 163.14 g/mol. Its IUPAC name is 1H-pyrazolo[5,4-b]pyridine-6-carboxylic acid.
Molecular Properties
| Compound Name | 1H-pyrazolo[5,4-b]pyridine-6-carboxylic acid |
| PubChem CID | 67251082 |
| Molecular Formula | C7H5N3O2 |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 1H-pyrazolo[5,4-b]pyridine-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2cn[nH]c2n1 |
| InChI | InChI=1S/C7H5N3O2/c11-7(12)5-2-1-4-3-8-10-6(4)9-5/h1-3H,(H,11,12)(H,8,9,10) |
| InChIKey | UHBHAVOFBLUPBB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrazolo[5,4-b]pyridine-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazolo[5,4-b]pyridine-6-carboxylic acid?
The IUPAC name of 1H-pyrazolo[5,4-b]pyridine-6-carboxylic acid (CID 67251082) is 1H-pyrazolo[5,4-b]pyridine-6-carboxylic acid.
What is the SMILES notation for 1H-pyrazolo[5,4-b]pyridine-6-carboxylic acid?
The canonical SMILES for 1H-pyrazolo[5,4-b]pyridine-6-carboxylic acid is O=C(O)c1ccc2cn[nH]c2n1.
What is the InChIKey of 1H-pyrazolo[5,4-b]pyridine-6-carboxylic acid?
The InChIKey is UHBHAVOFBLUPBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2/c11-7(12)5-2-1-4-3-8-10-6(4)9-5/h1-3H,(H,11,12)(H,8,9,10).
What are the key properties of 1H-pyrazolo[5,4-b]pyridine-6-carboxylic acid?
1H-pyrazolo[5,4-b]pyridine-6-carboxylic acid has a molecular weight of 163.14 g/mol, XLogP of 0.66, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazolo[5,4-b]pyridine-6-carboxylic acid is sourced from PubChem (CID 67251082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).