C23H24F2N2O4S — CID 67251204
(E)-2-(4-cyclopropylsulfonylphenyl)-3-[(3S,4R)-3,4-difluorocyclopentyl]-N-[5-(hydroxymethyl)-2-pyridinyl]prop-2-enamide (PubChem CID 67251204) has the molecular formula C23H24F2N2O4S and a molecular weight of 462.52 g/mol. Its IUPAC name is (E)-2-(4-cyclopropylsulfonylphenyl)-3-[(3S,4R)-3,4-difluorocyclopentyl]-N-[5-(hydroxymethyl)-2-pyridinyl]prop-2-enamide.
| Compound Name | (E)-2-(4-cyclopropylsulfonylphenyl)-3-[(3S,4R)-3,4-difluorocyclopentyl]-N-[5-(hydroxymethyl)-2-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 67251204 |
| Molecular Formula | C23H24F2N2O4S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | (E)-2-(4-cyclopropylsulfonylphenyl)-3-[(3S,4R)-3,4-difluorocyclopentyl]-N-[5-(hydroxymethyl)-2-pyridinyl]prop-2-enamide |
| SMILES | O=C(Nc1ccc(CO)cn1)/C(=C/C1C[C@@H](F)[C@@H](F)C1)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C23H24F2N2O4S/c24-20-10-15(11-21(20)25)9-19(23(29)27-22-8-1-14(13-28)12-26-22)16-2-4-17(5-3-16)32(30,31)18-6-7-18/h1-5,8-9,12,15,18,20-21,28H,6-7,10-11,13H2,(H,26,27,29)/b19-9+/t15?,20-,21+ |
| InChIKey | IEPMEOQFMOKKQA-OUIBPNBTSA-N |
| XLogP | 3.62 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|