C34H51NO3 — CID 6725131
cyclohexyl-[(1R,2S,5S,6S,9R,10R,15R)-5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 6725131) has the molecular formula C34H51NO3 and a molecular weight of 521.79 g/mol. Its IUPAC name is cyclohexyl-[(1R,2S,5S,6S,9R,10R,15R)-5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | cyclohexyl-[(1R,2S,5S,6S,9R,10R,15R)-5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 6725131 |
| Molecular Formula | C34H51NO3 |
| Molecular Weight | 521.79 g/mol |
| Exact Mass | 521.39 |
| IUPAC Name | cyclohexyl-[(1R,2S,5S,6S,9R,10R,15R)-5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | C[C@]12CC[C@H]3[C@]4(C=C[C@@]5(C=C4C(=O)C4CCCCC4)CC(O)CC[C@]35C)[C@@H]1CC[C@@]2(O)CN1CCCCC1 |
| InChI | InChI=1S/C34H51NO3/c1-30-14-11-25(36)21-32(30)17-18-34(26(22-32)29(37)24-9-5-3-6-10-24)27(30)12-15-31(2)28(34)13-16-33(31,38)23-35-19-7-4-8-20-35/h17-18,22,24-25,27-28,36,38H,3-16,19-21,23H2,1-2H3/t25?,27-,28-,30-,31+,32+,33-,34-/m1/s1 |
| InChIKey | NTEDYSAAZCIVBU-XUYMXCAZSA-N |
| XLogP | 6.21 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.79 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|