C23H20Cl2N2O2 — CID 67251847
4-(chloromethyl)-N-[4-[[4-(chloromethyl)benzoyl]amino]-3-methylphenyl]benzamide (PubChem CID 67251847) has the molecular formula C23H20Cl2N2O2 and a molecular weight of 427.33 g/mol. Its IUPAC name is 4-(chloromethyl)-N-[4-[[4-(chloromethyl)benzoyl]amino]-3-methylphenyl]benzamide.
| Compound Name | 4-(chloromethyl)-N-[4-[[4-(chloromethyl)benzoyl]amino]-3-methylphenyl]benzamide |
|---|---|
| PubChem CID | 67251847 |
| Molecular Formula | C23H20Cl2N2O2 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 4-(chloromethyl)-N-[4-[[4-(chloromethyl)benzoyl]amino]-3-methylphenyl]benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(CCl)cc2)ccc1NC(=O)c1ccc(CCl)cc1 |
| InChI | InChI=1S/C23H20Cl2N2O2/c1-15-12-20(26-22(28)18-6-2-16(13-24)3-7-18)10-11-21(15)27-23(29)19-8-4-17(14-25)5-9-19/h2-12H,13-14H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | SXYNHMBIUDQVDQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|