About 9-phenylnonylcarbamic acid
9-phenylnonylcarbamic acid (PubChem CID 67252082) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is 9-phenylnonylcarbamic acid.
Molecular Properties
| Compound Name | 9-phenylnonylcarbamic acid |
| PubChem CID | 67252082 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 9-phenylnonylcarbamic acid |
| SMILES | O=C(O)NCCCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C16H25NO2/c18-16(19)17-14-10-5-3-1-2-4-7-11-15-12-8-6-9-13-15/h6,8-9,12-13,17H,1-5,7,10-11,14H2,(H,18,19) |
| InChIKey | HDLAPEMWINLXAB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-phenylnonylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-phenylnonylcarbamic acid?
The IUPAC name of 9-phenylnonylcarbamic acid (CID 67252082) is 9-phenylnonylcarbamic acid.
What is the SMILES notation for 9-phenylnonylcarbamic acid?
The canonical SMILES for 9-phenylnonylcarbamic acid is O=C(O)NCCCCCCCCCc1ccccc1.
What is the InChIKey of 9-phenylnonylcarbamic acid?
The InChIKey is HDLAPEMWINLXAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c18-16(19)17-14-10-5-3-1-2-4-7-11-15-12-8-6-9-13-15/h6,8-9,12-13,17H,1-5,7,10-11,14H2,(H,18,19).
What are the key properties of 9-phenylnonylcarbamic acid?
9-phenylnonylcarbamic acid has a molecular weight of 263.38 g/mol, XLogP of 4.23, 10 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-phenylnonylcarbamic acid is sourced from PubChem (CID 67252082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).