C14H13ClF3NO2 — CID 67252138
2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxylic acid;hydrochloride (PubChem CID 67252138) has the molecular formula C14H13ClF3NO2 and a molecular weight of 319.71 g/mol. Its IUPAC name is 2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxylic acid;hydrochloride.
| Compound Name | 2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 67252138 |
| Molecular Formula | C14H13ClF3NO2 |
| Molecular Weight | 319.71 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxylic acid;hydrochloride |
| SMILES | Cc1cc(C(=O)O)c(C)n1-c1ccccc1C(F)(F)F.Cl |
| InChI | InChI=1S/C14H12F3NO2.ClH/c1-8-7-10(13(19)20)9(2)18(8)12-6-4-3-5-11(12)14(15,16)17;/h3-7H,1-2H3,(H,19,20);1H |
| InChIKey | SXZOOEVQAUXAQL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.71 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|