C19H16N4O — CID 672522
trans-(3S,4S)-5-oxo-3-phenyl-4-propylcyclohexane-1,1,2,2-tetracarbonitrile (PubChem CID 672522) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is trans-(3S,4S)-5-oxo-3-phenyl-4-propylcyclohexane-1,1,2,2-tetracarbonitrile.
| Compound Name | trans-(3S,4S)-5-oxo-3-phenyl-4-propylcyclohexane-1,1,2,2-tetracarbonitrile |
|---|---|
| PubChem CID | 672522 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | trans-(3S,4S)-5-oxo-3-phenyl-4-propylcyclohexane-1,1,2,2-tetracarbonitrile |
| SMILES | CCC[C@@H]1C(=O)CC(C#N)(C#N)C(C#N)(C#N)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H16N4O/c1-2-6-15-16(24)9-18(10-20,11-21)19(12-22,13-23)17(15)14-7-4-3-5-8-14/h3-5,7-8,15,17H,2,6,9H2,1H3/t15-,17-/m1/s1 |
| InChIKey | UFWCPPZHUZPDQI-NVXWUHKLSA-N |
| XLogP | 3.23 |
| TPSA | 112.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|