C20H26N4Na2O8 — CID 67252333
disodium;4-[4-[5-[4-[[(E)-3-carboxylatoprop-2-enoyl]amino]butyl]-3,6-dioxopiperazin-2-yl]butylamino]-4-oxobut-2-enoate (PubChem CID 67252333) has the molecular formula C20H26N4Na2O8 and a molecular weight of 496.43 g/mol. Its IUPAC name is disodium;4-[4-[5-[4-[[(E)-3-carboxylatoprop-2-enoyl]amino]butyl]-3,6-dioxopiperazin-2-yl]butylamino]-4-oxobut-2-enoate.
| Compound Name | disodium;4-[4-[5-[4-[[(E)-3-carboxylatoprop-2-enoyl]amino]butyl]-3,6-dioxopiperazin-2-yl]butylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 67252333 |
| Molecular Formula | C20H26N4Na2O8 |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | disodium;4-[4-[5-[4-[[(E)-3-carboxylatoprop-2-enoyl]amino]butyl]-3,6-dioxopiperazin-2-yl]butylamino]-4-oxobut-2-enoate |
| SMILES | O=C([O-])C=CC(=O)NCCCCC1NC(=O)C(CCCCNC(=O)/C=C/C(=O)[O-])NC1=O.[Na+].[Na+] |
| InChI | InChI=1S/C20H28N4O8.2Na/c25-15(7-9-17(27)28)21-11-3-1-5-13-19(31)24-14(20(32)23-13)6-2-4-12-22-16(26)8-10-18(29)30;;/h7-10,13-14H,1-6,11-12H2,(H,21,25)(H,22,26)(H,23,32)(H,24,31)(H,27,28)(H,29,30);;/q;2*+1/p-2/b9-7+,10-8?;; |
| InChIKey | QHOYIPBOOMNUAT-TZGKNUOGSA-L |
| XLogP | -9.84 |
| TPSA | 196.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | -9.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|