C32H43NO4S — CID 6725296
[(1R,2S,5S,6S,9R,10R,15R)-5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(5-methylthiophen-2-yl)methanone (PubChem CID 6725296) has the molecular formula C32H43NO4S and a molecular weight of 537.77 g/mol. Its IUPAC name is [(1R,2S,5S,6S,9R,10R,15R)-5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(5-methylthiophen-2-yl)methanone.
| Compound Name | [(1R,2S,5S,6S,9R,10R,15R)-5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 6725296 |
| Molecular Formula | C32H43NO4S |
| Molecular Weight | 537.77 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | [(1R,2S,5S,6S,9R,10R,15R)-5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(5-methylthiophen-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)C2=C[C@@]34C=C[C@@]25[C@@H]2CC[C@@](O)(CN6CCOCC6)[C@@]2(C)CC[C@@H]5[C@@]3(C)CCC(O)C4)s1 |
| InChI | InChI=1S/C32H43NO4S/c1-21-4-5-24(38-21)27(35)23-19-30-12-13-32(23)25(28(30,2)9-6-22(34)18-30)7-10-29(3)26(32)8-11-31(29,36)20-33-14-16-37-17-15-33/h4-5,12-13,19,22,25-26,34,36H,6-11,14-18,20H2,1-3H3/t22?,25-,26-,28-,29+,30+,31-,32-/m1/s1 |
| InChIKey | UNZPVWKCAFZDMD-XDVIUURPSA-N |
| XLogP | 5.16 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.77 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|