C35H49NO3S — CID 6725331
[(1R,2S,5S,6S,9R,10R,15R)-5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(5-methylthiophen-2-yl)methanone (PubChem CID 6725331) has the molecular formula C35H49NO3S and a molecular weight of 563.85 g/mol. Its IUPAC name is [(1R,2S,5S,6S,9R,10R,15R)-5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(5-methylthiophen-2-yl)methanone.
| Compound Name | [(1R,2S,5S,6S,9R,10R,15R)-5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 6725331 |
| Molecular Formula | C35H49NO3S |
| Molecular Weight | 563.85 g/mol |
| Exact Mass | 563.34 |
| IUPAC Name | [(1R,2S,5S,6S,9R,10R,15R)-5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(5-methylthiophen-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)C2=C[C@@]34C=C[C@@]25[C@@H]2CC[C@@](O)(CN6CCCCCCC6)[C@@]2(C)CC[C@@H]5[C@@]3(C)CCC(O)C4)s1 |
| InChI | InChI=1S/C35H49NO3S/c1-24-9-10-27(40-24)30(38)26-22-33-17-18-35(26)28(31(33,2)14-11-25(37)21-33)12-15-32(3)29(35)13-16-34(32,39)23-36-19-7-5-4-6-8-20-36/h9-10,17-18,22,25,28-29,37,39H,4-8,11-16,19-21,23H2,1-3H3/t25?,28-,29-,31-,32+,33+,34-,35-/m1/s1 |
| InChIKey | FJXDWCGGCAZHIS-MFXAHHOXSA-N |
| XLogP | 7.10 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.85 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|