C33H37N3O3S2 — CID 6725353
1-benzothiophen-2-yl-[(2S,5S,6S,13S)-5,13-dihydroxy-6,10-dimethyl-5-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone (PubChem CID 6725353) has the molecular formula C33H37N3O3S2 and a molecular weight of 587.81 g/mol. Its IUPAC name is 1-benzothiophen-2-yl-[(2S,5S,6S,13S)-5,13-dihydroxy-6,10-dimethyl-5-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone.
| Compound Name | 1-benzothiophen-2-yl-[(2S,5S,6S,13S)-5,13-dihydroxy-6,10-dimethyl-5-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
|---|---|
| PubChem CID | 6725353 |
| Molecular Formula | C33H37N3O3S2 |
| Molecular Weight | 587.81 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | 1-benzothiophen-2-yl-[(2S,5S,6S,13S)-5,13-dihydroxy-6,10-dimethyl-5-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
| SMILES | CC1=CCC[C@@]2(C)[C@@H](CC[C@@]2(O)CSc2ncn[nH]2)c2ccc(cc2C(=O)c2cc3ccccc3s2)C[C@@H](O)CC1 |
| InChI | InChI=1S/C33H37N3O3S2/c1-21-6-5-14-32(2)27(13-15-33(32,39)19-40-31-34-20-35-36-31)25-12-10-22(16-24(37)11-9-21)17-26(25)30(38)29-18-23-7-3-4-8-28(23)41-29/h3-4,6-8,10,12,17-18,20,24,27,37,39H,5,9,11,13-16,19H2,1-2H3,(H,34,35,36)/t24-,27-,32-,33+/m0/s1 |
| InChIKey | BAAUMKOEYCYDNV-BMQXEJLFSA-N |
| XLogP | 7.08 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.81 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|