About 5-(2-fluoroethyl)-1,3-oxazolidin-2-one
5-(2-fluoroethyl)-1,3-oxazolidin-2-one (PubChem CID 67254988) has the molecular formula C5H8FNO2
and a molecular weight of 133.12 g/mol. Its IUPAC name is 5-(2-fluoroethyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 5-(2-fluoroethyl)-1,3-oxazolidin-2-one |
| PubChem CID | 67254988 |
| Molecular Formula | C5H8FNO2 |
| Molecular Weight | 133.12 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | 5-(2-fluoroethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1NCC(CCF)O1 |
| InChI | InChI=1S/C5H8FNO2/c6-2-1-4-3-7-5(8)9-4/h4H,1-3H2,(H,7,8) |
| InChIKey | GDUDJTGUDDQWJH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.12 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2-fluoroethyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-fluoroethyl)-1,3-oxazolidin-2-one?
The IUPAC name of 5-(2-fluoroethyl)-1,3-oxazolidin-2-one (CID 67254988) is 5-(2-fluoroethyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for 5-(2-fluoroethyl)-1,3-oxazolidin-2-one?
The canonical SMILES for 5-(2-fluoroethyl)-1,3-oxazolidin-2-one is O=C1NCC(CCF)O1.
What is the InChIKey of 5-(2-fluoroethyl)-1,3-oxazolidin-2-one?
The InChIKey is GDUDJTGUDDQWJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8FNO2/c6-2-1-4-3-7-5(8)9-4/h4H,1-3H2,(H,7,8).
What are the key properties of 5-(2-fluoroethyl)-1,3-oxazolidin-2-one?
5-(2-fluoroethyl)-1,3-oxazolidin-2-one has a molecular weight of 133.12 g/mol, XLogP of 0.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluoroethyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 67254988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).