About Tetramethyl-1,3-dioxolane-4-carboxylic acid
Tetramethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 67255291) has the molecular formula C8H14O4
and a molecular weight of 174.19 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-1,3-dioxolane-4-carboxylic acid.
Molecular Properties
| Compound Name | Tetramethyl-1,3-dioxolane-4-carboxylic acid |
| PubChem CID | 67255291 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.19 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 2,2,5,5-tetramethyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | CC1(C(OC(O1)(C)C)C(=O)O)C |
| InChI | InChI=1S/C8H14O4/c1-7(2)5(6(9)10)11-8(3,4)12-7/h5H,1-4H3,(H,9,10) |
| InChIKey | DJEUAAXKJCIEQT-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 55.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | 207 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.19 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Tetramethyl-1,3-dioxolane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tetramethyl-1,3-dioxolane-4-carboxylic acid?
The IUPAC name of Tetramethyl-1,3-dioxolane-4-carboxylic acid (CID 67255291) is 2,2,5,5-tetramethyl-1,3-dioxolane-4-carboxylic acid.
What is the SMILES notation for Tetramethyl-1,3-dioxolane-4-carboxylic acid?
The canonical SMILES for Tetramethyl-1,3-dioxolane-4-carboxylic acid is CC1(C(OC(O1)(C)C)C(=O)O)C.
What is the InChIKey of Tetramethyl-1,3-dioxolane-4-carboxylic acid?
The InChIKey is DJEUAAXKJCIEQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4/c1-7(2)5(6(9)10)11-8(3,4)12-7/h5H,1-4H3,(H,9,10).
What are the key properties of Tetramethyl-1,3-dioxolane-4-carboxylic acid?
Tetramethyl-1,3-dioxolane-4-carboxylic acid has a molecular weight of 174.19 g/mol, XLogP of 0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Tetramethyl-1,3-dioxolane-4-carboxylic acid is sourced from PubChem (CID 67255291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).