Tetramethyl-1,3-dioxolane-4-carboxylic acid

C8H14O4 — CID 67255291

IUPAC2,2,5,5-tetramethyl-1,3-dioxolane-4-carboxylic acid
SMILESCC1(C(OC(O1)(C)C)C(=O)O)C
InChIInChI=1S/C8H14O4/c1-7(2)5(6(9)10)11-8(3,4)12-7/h5H,1-4H3,(H,9,10)
InChIKeyDJEUAAXKJCIEQT-UHFFFAOYSA-N
MW174.19 g/mol
LogP0.70
Rot. Bonds1

About Tetramethyl-1,3-dioxolane-4-carboxylic acid

Tetramethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 67255291) has the molecular formula C8H14O4 and a molecular weight of 174.19 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-1,3-dioxolane-4-carboxylic acid.

Molecular Properties

Compound NameTetramethyl-1,3-dioxolane-4-carboxylic acid
PubChem CID67255291
Molecular FormulaC8H14O4
Molecular Weight174.19 g/mol
Exact Mass174.09
IUPAC Name2,2,5,5-tetramethyl-1,3-dioxolane-4-carboxylic acid
SMILESCC1(C(OC(O1)(C)C)C(=O)O)C
InChIInChI=1S/C8H14O4/c1-7(2)5(6(9)10)11-8(3,4)12-7/h5H,1-4H3,(H,9,10)
InChIKeyDJEUAAXKJCIEQT-UHFFFAOYSA-N
XLogP0.70
TPSA55.80 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity207

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.19
LogP ≤ 50.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze Tetramethyl-1,3-dioxolane-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of Tetramethyl-1,3-dioxolane-4-carboxylic acid?
The IUPAC name of Tetramethyl-1,3-dioxolane-4-carboxylic acid (CID 67255291) is 2,2,5,5-tetramethyl-1,3-dioxolane-4-carboxylic acid.
What is the SMILES notation for Tetramethyl-1,3-dioxolane-4-carboxylic acid?
The canonical SMILES for Tetramethyl-1,3-dioxolane-4-carboxylic acid is CC1(C(OC(O1)(C)C)C(=O)O)C.
What is the InChIKey of Tetramethyl-1,3-dioxolane-4-carboxylic acid?
The InChIKey is DJEUAAXKJCIEQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4/c1-7(2)5(6(9)10)11-8(3,4)12-7/h5H,1-4H3,(H,9,10).
What are the key properties of Tetramethyl-1,3-dioxolane-4-carboxylic acid?
Tetramethyl-1,3-dioxolane-4-carboxylic acid has a molecular weight of 174.19 g/mol, XLogP of 0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Tetramethyl-1,3-dioxolane-4-carboxylic acid is sourced from PubChem (CID 67255291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).