C21H22FN3O2 — CID 67255664
tert-butyl 10-(3-fluorophenyl)-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxylate (PubChem CID 67255664) has the molecular formula C21H22FN3O2 and a molecular weight of 367.42 g/mol. Its IUPAC name is tert-butyl 10-(3-fluorophenyl)-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxylate.
| Compound Name | tert-butyl 10-(3-fluorophenyl)-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 67255664 |
| Molecular Formula | C21H22FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | tert-butyl 10-(3-fluorophenyl)-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c([nH]c3cccnc23)C1c1cccc(F)c1 |
| InChI | InChI=1S/C21H22FN3O2/c1-21(2,3)27-20(26)25-11-9-15-17-16(8-5-10-23-17)24-18(15)19(25)13-6-4-7-14(22)12-13/h4-8,10,12,19,24H,9,11H2,1-3H3 |
| InChIKey | SWJHDJMHCLTXIS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |