About azane;bis(pyrrole-2,5-dione)
azane;bis(pyrrole-2,5-dione) (PubChem CID 67255756) has the molecular formula C8H9N3O4
and a molecular weight of 211.18 g/mol. Its IUPAC name is azane;bis(pyrrole-2,5-dione).
Molecular Properties
| Compound Name | azane;bis(pyrrole-2,5-dione) |
| PubChem CID | 67255756 |
| Molecular Formula | C8H9N3O4 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | azane;bis(pyrrole-2,5-dione) |
| SMILES | N.O=C1C=CC(=O)N1.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/2C4H3NO2.H3N/c2*6-3-1-2-4(7)5-3;/h2*1-2H,(H,5,6,7);1H3 |
| InChIKey | NKLUPKRFSHTTDB-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 127.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze azane;bis(pyrrole-2,5-dione) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;bis(pyrrole-2,5-dione)?
The IUPAC name of azane;bis(pyrrole-2,5-dione) (CID 67255756) is azane;bis(pyrrole-2,5-dione).
What is the SMILES notation for azane;bis(pyrrole-2,5-dione)?
The canonical SMILES for azane;bis(pyrrole-2,5-dione) is N.O=C1C=CC(=O)N1.O=C1C=CC(=O)N1.
What is the InChIKey of azane;bis(pyrrole-2,5-dione)?
The InChIKey is NKLUPKRFSHTTDB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H3NO2.H3N/c2*6-3-1-2-4(7)5-3;/h2*1-2H,(H,5,6,7);1H3.
What are the key properties of azane;bis(pyrrole-2,5-dione)?
azane;bis(pyrrole-2,5-dione) has a molecular weight of 211.18 g/mol, XLogP of -1.44, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;bis(pyrrole-2,5-dione) is sourced from PubChem (CID 67255756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).