C6H10F2N2O — CID 67255831
4-(2,2-difluoroethyl)-1-methylimidazolidin-2-one (PubChem CID 67255831) has the molecular formula C6H10F2N2O and a molecular weight of 164.16 g/mol. Its IUPAC name is 4-(2,2-difluoroethyl)-1-methylimidazolidin-2-one.
| Compound Name | 4-(2,2-difluoroethyl)-1-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 67255831 |
| Molecular Formula | C6H10F2N2O |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 4-(2,2-difluoroethyl)-1-methylimidazolidin-2-one |
| SMILES | CN1CC(CC(F)F)NC1=O |
| InChI | InChI=1S/C6H10F2N2O/c1-10-3-4(2-5(7)8)9-6(10)11/h4-5H,2-3H2,1H3,(H,9,11) |
| InChIKey | XYNZPYZLCOPNGM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |