About 3-methyl-1-nitroindole
3-methyl-1-nitroindole (PubChem CID 67256017) has the molecular formula C9H8N2O2
and a molecular weight of 176.17 g/mol. Its IUPAC name is 3-methyl-1-nitroindole.
Molecular Properties
| Compound Name | 3-methyl-1-nitroindole |
| PubChem CID | 67256017 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 3-methyl-1-nitroindole |
| SMILES | Cc1cn([N+](=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C9H8N2O2/c1-7-6-10(11(12)13)9-5-3-2-4-8(7)9/h2-6H,1H3 |
| InChIKey | WAJVIALFRQVUJA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1-nitroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-nitroindole?
The IUPAC name of 3-methyl-1-nitroindole (CID 67256017) is 3-methyl-1-nitroindole.
What is the SMILES notation for 3-methyl-1-nitroindole?
The canonical SMILES for 3-methyl-1-nitroindole is Cc1cn([N+](=O)[O-])c2ccccc12.
What is the InChIKey of 3-methyl-1-nitroindole?
The InChIKey is WAJVIALFRQVUJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c1-7-6-10(11(12)13)9-5-3-2-4-8(7)9/h2-6H,1H3.
What are the key properties of 3-methyl-1-nitroindole?
3-methyl-1-nitroindole has a molecular weight of 176.17 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-nitroindole is sourced from PubChem (CID 67256017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).