About 4-(difluoromethyl)-1,3-dimethylimidazolidin-2-one
4-(difluoromethyl)-1,3-dimethylimidazolidin-2-one (PubChem CID 67256131) has the molecular formula C6H10F2N2O
and a molecular weight of 164.16 g/mol. Its IUPAC name is 4-(difluoromethyl)-1,3-dimethylimidazolidin-2-one.
Molecular Properties
| Compound Name | 4-(difluoromethyl)-1,3-dimethylimidazolidin-2-one |
| PubChem CID | 67256131 |
| Molecular Formula | C6H10F2N2O |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 4-(difluoromethyl)-1,3-dimethylimidazolidin-2-one |
| SMILES | CN1CC(C(F)F)N(C)C1=O |
| InChI | InChI=1S/C6H10F2N2O/c1-9-3-4(5(7)8)10(2)6(9)11/h4-5H,3H2,1-2H3 |
| InChIKey | PDKJBDVVQIEEHC-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(difluoromethyl)-1,3-dimethylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethyl)-1,3-dimethylimidazolidin-2-one?
The IUPAC name of 4-(difluoromethyl)-1,3-dimethylimidazolidin-2-one (CID 67256131) is 4-(difluoromethyl)-1,3-dimethylimidazolidin-2-one.
What is the SMILES notation for 4-(difluoromethyl)-1,3-dimethylimidazolidin-2-one?
The canonical SMILES for 4-(difluoromethyl)-1,3-dimethylimidazolidin-2-one is CN1CC(C(F)F)N(C)C1=O.
What is the InChIKey of 4-(difluoromethyl)-1,3-dimethylimidazolidin-2-one?
The InChIKey is PDKJBDVVQIEEHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F2N2O/c1-9-3-4(5(7)8)10(2)6(9)11/h4-5H,3H2,1-2H3.
What are the key properties of 4-(difluoromethyl)-1,3-dimethylimidazolidin-2-one?
4-(difluoromethyl)-1,3-dimethylimidazolidin-2-one has a molecular weight of 164.16 g/mol, XLogP of 0.62, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethyl)-1,3-dimethylimidazolidin-2-one is sourced from PubChem (CID 67256131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).