C33H36N4O4 — CID 67256145
tert-butyl-[1-[4-[1-(4-cyanobutyl)-2-oxo-7-phenylpyrido[2,3-b][1,4]oxazin-6-yl]phenyl]cyclobutyl]carbamic acid (PubChem CID 67256145) has the molecular formula C33H36N4O4 and a molecular weight of 552.68 g/mol. Its IUPAC name is tert-butyl-[1-[4-[1-(4-cyanobutyl)-2-oxo-7-phenylpyrido[2,3-b][1,4]oxazin-6-yl]phenyl]cyclobutyl]carbamic acid.
| Compound Name | tert-butyl-[1-[4-[1-(4-cyanobutyl)-2-oxo-7-phenylpyrido[2,3-b][1,4]oxazin-6-yl]phenyl]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 67256145 |
| Molecular Formula | C33H36N4O4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | tert-butyl-[1-[4-[1-(4-cyanobutyl)-2-oxo-7-phenylpyrido[2,3-b][1,4]oxazin-6-yl]phenyl]cyclobutyl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1(c2ccc(-c3nc4c(cc3-c3ccccc3)N(CCCCC#N)C(=O)CO4)cc2)CCC1 |
| InChI | InChI=1S/C33H36N4O4/c1-32(2,3)37(31(39)40)33(17-10-18-33)25-15-13-24(14-16-25)29-26(23-11-6-4-7-12-23)21-27-30(35-29)41-22-28(38)36(27)20-9-5-8-19-34/h4,6-7,11-16,21H,5,8-10,17-18,20,22H2,1-3H3,(H,39,40) |
| InChIKey | KDITUKQFLZETQZ-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 106.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|