About pentyl diphenyl borate
pentyl diphenyl borate (PubChem CID 67256400) has the molecular formula C17H21BO3
and a molecular weight of 284.16 g/mol. Its IUPAC name is pentyl diphenyl borate.
Molecular Properties
| Compound Name | pentyl diphenyl borate |
| PubChem CID | 67256400 |
| Molecular Formula | C17H21BO3 |
| Molecular Weight | 284.16 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | pentyl diphenyl borate |
| SMILES | CCCCCOB(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C17H21BO3/c1-2-3-10-15-19-18(20-16-11-6-4-7-12-16)21-17-13-8-5-9-14-17/h4-9,11-14H,2-3,10,15H2,1H3 |
| InChIKey | NSCKJVDDGQOITO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.16 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze pentyl diphenyl borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl diphenyl borate?
The IUPAC name of pentyl diphenyl borate (CID 67256400) is pentyl diphenyl borate.
What is the SMILES notation for pentyl diphenyl borate?
The canonical SMILES for pentyl diphenyl borate is CCCCCOB(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of pentyl diphenyl borate?
The InChIKey is NSCKJVDDGQOITO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21BO3/c1-2-3-10-15-19-18(20-16-11-6-4-7-12-16)21-17-13-8-5-9-14-17/h4-9,11-14H,2-3,10,15H2,1H3.
What are the key properties of pentyl diphenyl borate?
pentyl diphenyl borate has a molecular weight of 284.16 g/mol, XLogP of 4.34, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl diphenyl borate is sourced from PubChem (CID 67256400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).