C15H16N8S — CID 67256532
4-[5-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-1-methyl-1,2,4-triazol-3-yl]-1,3-thiazole (PubChem CID 67256532) has the molecular formula C15H16N8S and a molecular weight of 340.42 g/mol. Its IUPAC name is 4-[5-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-1-methyl-1,2,4-triazol-3-yl]-1,3-thiazole.
| Compound Name | 4-[5-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-1-methyl-1,2,4-triazol-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 67256532 |
| Molecular Formula | C15H16N8S |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4-[5-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-1-methyl-1,2,4-triazol-3-yl]-1,3-thiazole |
| SMILES | Cc1ncc(C)n2nc(CCc3nc(-c4cscn4)nn3C)nc12 |
| InChI | InChI=1S/C15H16N8S/c1-9-6-16-10(2)15-18-12(20-23(9)15)4-5-13-19-14(21-22(13)3)11-7-24-8-17-11/h6-8H,4-5H2,1-3H3 |
| InChIKey | YQLCQOXAZADIQE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 86.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |