C34H45N3O4 — CID 6725669
furan-2-yl-[(2S,5S,6S,13S)-5-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone (PubChem CID 6725669) has the molecular formula C34H45N3O4 and a molecular weight of 559.75 g/mol. Its IUPAC name is furan-2-yl-[(2S,5S,6S,13S)-5-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone.
| Compound Name | furan-2-yl-[(2S,5S,6S,13S)-5-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
|---|---|
| PubChem CID | 6725669 |
| Molecular Formula | C34H45N3O4 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.34 |
| IUPAC Name | furan-2-yl-[(2S,5S,6S,13S)-5-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
| SMILES | CC1=CCC[C@@]2(C)[C@@H](CC[C@@]2(O)CN2CCCN3CCCN=C32)c2ccc(cc2C(=O)c2ccco2)C[C@@H](O)CC1 |
| InChI | InChI=1S/C34H45N3O4/c1-24-7-3-14-33(2)29(13-15-34(33,40)23-37-19-6-18-36-17-5-16-35-32(36)37)27-12-10-25(21-26(38)11-9-24)22-28(27)31(39)30-8-4-20-41-30/h4,7-8,10,12,20,22,26,29,38,40H,3,5-6,9,11,13-19,21,23H2,1-2H3/t26-,29-,33-,34+/m0/s1 |
| InChIKey | CYBPTJINKMJWKR-PRLHHBRKSA-N |
| XLogP | 5.32 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|