About 3-(1,3-thiazol-2-yl)cycloheptane-1-carboxylic acid
3-(1,3-thiazol-2-yl)cycloheptane-1-carboxylic acid (PubChem CID 67256904) has the molecular formula C11H15NO2S
and a molecular weight of 225.31 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-yl)cycloheptane-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-(1,3-thiazol-2-yl)cycloheptane-1-carboxylic acid |
| PubChem CID | 67256904 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 3-(1,3-thiazol-2-yl)cycloheptane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC(c2nccs2)C1 |
| InChI | InChI=1S/C11H15NO2S/c13-11(14)9-4-2-1-3-8(7-9)10-12-5-6-15-10/h5-6,8-9H,1-4,7H2,(H,13,14) |
| InChIKey | MHVJOQMYWWLNRN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,3-thiazol-2-yl)cycloheptane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-thiazol-2-yl)cycloheptane-1-carboxylic acid?
The IUPAC name of 3-(1,3-thiazol-2-yl)cycloheptane-1-carboxylic acid (CID 67256904) is 3-(1,3-thiazol-2-yl)cycloheptane-1-carboxylic acid.
What is the SMILES notation for 3-(1,3-thiazol-2-yl)cycloheptane-1-carboxylic acid?
The canonical SMILES for 3-(1,3-thiazol-2-yl)cycloheptane-1-carboxylic acid is O=C(O)C1CCCCC(c2nccs2)C1.
What is the InChIKey of 3-(1,3-thiazol-2-yl)cycloheptane-1-carboxylic acid?
The InChIKey is MHVJOQMYWWLNRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2S/c13-11(14)9-4-2-1-3-8(7-9)10-12-5-6-15-10/h5-6,8-9H,1-4,7H2,(H,13,14).
What are the key properties of 3-(1,3-thiazol-2-yl)cycloheptane-1-carboxylic acid?
3-(1,3-thiazol-2-yl)cycloheptane-1-carboxylic acid has a molecular weight of 225.31 g/mol, XLogP of 2.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-thiazol-2-yl)cycloheptane-1-carboxylic acid is sourced from PubChem (CID 67256904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).