C26H26N6O — CID 67256969
11-[4-(1-aminocyclobutyl)phenyl]-N,N-dimethyl-12-phenyl-8-oxa-2,4,5,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-3-amine (PubChem CID 67256969) has the molecular formula C26H26N6O and a molecular weight of 438.54 g/mol. Its IUPAC name is 11-[4-(1-aminocyclobutyl)phenyl]-N,N-dimethyl-12-phenyl-8-oxa-2,4,5,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-3-amine.
| Compound Name | 11-[4-(1-aminocyclobutyl)phenyl]-N,N-dimethyl-12-phenyl-8-oxa-2,4,5,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-3-amine |
|---|---|
| PubChem CID | 67256969 |
| Molecular Formula | C26H26N6O |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 11-[4-(1-aminocyclobutyl)phenyl]-N,N-dimethyl-12-phenyl-8-oxa-2,4,5,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-3-amine |
| SMILES | CN(C)c1nnc2n1-c1cc(-c3ccccc3)c(-c3ccc(C4(N)CCC4)cc3)nc1OC2 |
| InChI | InChI=1S/C26H26N6O/c1-31(2)25-30-29-22-16-33-24-21(32(22)25)15-20(17-7-4-3-5-8-17)23(28-24)18-9-11-19(12-10-18)26(27)13-6-14-26/h3-5,7-12,15H,6,13-14,16,27H2,1-2H3 |
| InChIKey | WFWFLSFDCGGSPQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |