C22H17F4N3O4 — CID 67257104
3-(2,6-difluorophenyl)-5-[5-(2,4-difluorophenyl)-2-(1,2-dihydroxypropan-2-yl)-1,3-oxazol-4-yl]-1,6-dihydropyrimidin-2-one (PubChem CID 67257104) has the molecular formula C22H17F4N3O4 and a molecular weight of 463.39 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-5-[5-(2,4-difluorophenyl)-2-(1,2-dihydroxypropan-2-yl)-1,3-oxazol-4-yl]-1,6-dihydropyrimidin-2-one.
| Compound Name | 3-(2,6-difluorophenyl)-5-[5-(2,4-difluorophenyl)-2-(1,2-dihydroxypropan-2-yl)-1,3-oxazol-4-yl]-1,6-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 67257104 |
| Molecular Formula | C22H17F4N3O4 |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 3-(2,6-difluorophenyl)-5-[5-(2,4-difluorophenyl)-2-(1,2-dihydroxypropan-2-yl)-1,3-oxazol-4-yl]-1,6-dihydropyrimidin-2-one |
| SMILES | CC(O)(CO)c1nc(C2=CN(c3c(F)cccc3F)C(=O)NC2)c(-c2ccc(F)cc2F)o1 |
| InChI | InChI=1S/C22H17F4N3O4/c1-22(32,10-30)20-28-17(19(33-20)13-6-5-12(23)7-16(13)26)11-8-27-21(31)29(9-11)18-14(24)3-2-4-15(18)25/h2-7,9,30,32H,8,10H2,1H3,(H,27,31) |
| InChIKey | CRSUJGHGIOUVIM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |