About (3-ethyl-1,2,4-thiadiazol-5-yl)methanol
(3-ethyl-1,2,4-thiadiazol-5-yl)methanol (PubChem CID 67257370) has the molecular formula C5H8N2OS
and a molecular weight of 144.20 g/mol. Its IUPAC name is (3-ethyl-1,2,4-thiadiazol-5-yl)methanol.
Molecular Properties
| Compound Name | (3-ethyl-1,2,4-thiadiazol-5-yl)methanol |
| PubChem CID | 67257370 |
| Molecular Formula | C5H8N2OS |
| Molecular Weight | 144.20 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | (3-ethyl-1,2,4-thiadiazol-5-yl)methanol |
| SMILES | CCc1nsc(CO)n1 |
| InChI | InChI=1S/C5H8N2OS/c1-2-4-6-5(3-8)9-7-4/h8H,2-3H2,1H3 |
| InChIKey | CCHCUPNPXSIVDD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.20 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-ethyl-1,2,4-thiadiazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-1,2,4-thiadiazol-5-yl)methanol?
The IUPAC name of (3-ethyl-1,2,4-thiadiazol-5-yl)methanol (CID 67257370) is (3-ethyl-1,2,4-thiadiazol-5-yl)methanol.
What is the SMILES notation for (3-ethyl-1,2,4-thiadiazol-5-yl)methanol?
The canonical SMILES for (3-ethyl-1,2,4-thiadiazol-5-yl)methanol is CCc1nsc(CO)n1.
What is the InChIKey of (3-ethyl-1,2,4-thiadiazol-5-yl)methanol?
The InChIKey is CCHCUPNPXSIVDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2OS/c1-2-4-6-5(3-8)9-7-4/h8H,2-3H2,1H3.
What are the key properties of (3-ethyl-1,2,4-thiadiazol-5-yl)methanol?
(3-ethyl-1,2,4-thiadiazol-5-yl)methanol has a molecular weight of 144.20 g/mol, XLogP of 0.59, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-1,2,4-thiadiazol-5-yl)methanol is sourced from PubChem (CID 67257370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).