2-methyl-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid

C11H15NO2S — CID 67257401

IUPAC2-methyl-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid
SMILESCC1C(C(=O)O)CCCC1c1nccs1
InChIInChI=1S/C11H15NO2S/c1-7-8(10-12-5-6-15-10)3-2-4-9(7)11(13)14/h5-9H,2-4H2,1H3,(H,13,14)
InChIKeyTXTPMHPCTCTCER-UHFFFAOYSA-N
MW225.31 g/mol
LogP2.75
Rot. Bonds2

About 2-methyl-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid

2-methyl-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid (PubChem CID 67257401) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 2-methyl-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name2-methyl-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid
PubChem CID67257401
Molecular FormulaC11H15NO2S
Molecular Weight225.31 g/mol
Exact Mass225.08
IUPAC Name2-methyl-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid
SMILESCC1C(C(=O)O)CCCC1c1nccs1
InChIInChI=1S/C11H15NO2S/c1-7-8(10-12-5-6-15-10)3-2-4-9(7)11(13)14/h5-9H,2-4H2,1H3,(H,13,14)
InChIKeyTXTPMHPCTCTCER-UHFFFAOYSA-N
XLogP2.75
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.31
LogP ≤ 52.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-methyl-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid?
The IUPAC name of 2-methyl-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid (CID 67257401) is 2-methyl-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 2-methyl-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid?
The canonical SMILES for 2-methyl-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid is CC1C(C(=O)O)CCCC1c1nccs1.
What is the InChIKey of 2-methyl-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid?
The InChIKey is TXTPMHPCTCTCER-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2S/c1-7-8(10-12-5-6-15-10)3-2-4-9(7)11(13)14/h5-9H,2-4H2,1H3,(H,13,14).
What are the key properties of 2-methyl-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid?
2-methyl-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid has a molecular weight of 225.31 g/mol, XLogP of 2.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 67257401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).