C16H17N7O — CID 67257897
2-[2-[5-(furan-2-yl)-2-methyl-1,2,4-triazol-3-yl]ethyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine (PubChem CID 67257897) has the molecular formula C16H17N7O and a molecular weight of 323.36 g/mol. Its IUPAC name is 2-[2-[5-(furan-2-yl)-2-methyl-1,2,4-triazol-3-yl]ethyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine.
| Compound Name | 2-[2-[5-(furan-2-yl)-2-methyl-1,2,4-triazol-3-yl]ethyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 67257897 |
| Molecular Formula | C16H17N7O |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-[2-[5-(furan-2-yl)-2-methyl-1,2,4-triazol-3-yl]ethyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine |
| SMILES | Cc1ncc(C)n2nc(CCc3nc(-c4ccco4)nn3C)nc12 |
| InChI | InChI=1S/C16H17N7O/c1-10-9-17-11(2)16-18-13(20-23(10)16)6-7-14-19-15(21-22(14)3)12-5-4-8-24-12/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | NFEVJZDNPVSZHU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 86.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |