About 2-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]ethanamine
2-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]ethanamine (PubChem CID 67258500) has the molecular formula C9H13NOS
and a molecular weight of 183.28 g/mol. Its IUPAC name is 2-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]ethanamine |
| PubChem CID | 67258500 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 2-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]ethanamine |
| SMILES | NCC[C@@H]1OCCc2ccsc21 |
| InChI | InChI=1S/C9H13NOS/c10-4-1-8-9-7(2-5-11-8)3-6-12-9/h3,6,8H,1-2,4-5,10H2/t8-/m0/s1 |
| InChIKey | JXUCWBWBFKYBEM-QMMMGPOBSA-N |
| XLogP | 1.71 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]ethanamine?
The IUPAC name of 2-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]ethanamine (CID 67258500) is 2-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]ethanamine.
What is the SMILES notation for 2-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]ethanamine?
The canonical SMILES for 2-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]ethanamine is NCC[C@@H]1OCCc2ccsc21.
What is the InChIKey of 2-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]ethanamine?
The InChIKey is JXUCWBWBFKYBEM-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H13NOS/c10-4-1-8-9-7(2-5-11-8)3-6-12-9/h3,6,8H,1-2,4-5,10H2/t8-/m0/s1.
What are the key properties of 2-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]ethanamine?
2-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]ethanamine has a molecular weight of 183.28 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]ethanamine is sourced from PubChem (CID 67258500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).