About zinc (2-methyl-3,4-dipropylphenyl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane
zinc (2-methyl-3,4-dipropylphenyl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane (PubChem CID 67258684) has the molecular formula C13H19O2PS2Zn
and a molecular weight of 367.79 g/mol. Its IUPAC name is zinc (2-methyl-3,4-dipropylphenyl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | zinc (2-methyl-3,4-dipropylphenyl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane |
| PubChem CID | 67258684 |
| Molecular Formula | C13H19O2PS2Zn |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | zinc (2-methyl-3,4-dipropylphenyl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane |
| SMILES | CCCc1ccc(SP([O-])([O-])=S)c(C)c1CCC.[Zn+2] |
| InChI | InChI=1S/C13H21O2PS2.Zn/c1-4-6-11-8-9-13(18-16(14,15)17)10(3)12(11)7-5-2;/h8-9H,4-7H2,1-3H3,(H2,14,15,17);/q;+2/p-2 |
| InChIKey | DAIDCNOEIKGXQG-UHFFFAOYSA-L |
| XLogP | 2.93 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze zinc (2-methyl-3,4-dipropylphenyl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc (2-methyl-3,4-dipropylphenyl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane?
The IUPAC name of zinc (2-methyl-3,4-dipropylphenyl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane (CID 67258684) is zinc (2-methyl-3,4-dipropylphenyl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane.
What is the SMILES notation for zinc (2-methyl-3,4-dipropylphenyl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane?
The canonical SMILES for zinc (2-methyl-3,4-dipropylphenyl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane is CCCc1ccc(SP([O-])([O-])=S)c(C)c1CCC.[Zn+2].
What is the InChIKey of zinc (2-methyl-3,4-dipropylphenyl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane?
The InChIKey is DAIDCNOEIKGXQG-UHFFFAOYSA-L. The full InChI is InChI=1S/C13H21O2PS2.Zn/c1-4-6-11-8-9-13(18-16(14,15)17)10(3)12(11)7-5-2;/h8-9H,4-7H2,1-3H3,(H2,14,15,17);/q;+2/p-2.
What are the key properties of zinc (2-methyl-3,4-dipropylphenyl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane?
zinc (2-methyl-3,4-dipropylphenyl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane has a molecular weight of 367.79 g/mol, XLogP of 2.93, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc (2-methyl-3,4-dipropylphenyl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 67258684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).