About 3-(1,3-thiazol-2-yl)oxan-4-ol
3-(1,3-thiazol-2-yl)oxan-4-ol (PubChem CID 67258700) has the molecular formula C8H11NO2S
and a molecular weight of 185.25 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-yl)oxan-4-ol.
Molecular Properties
| Compound Name | 3-(1,3-thiazol-2-yl)oxan-4-ol |
| PubChem CID | 67258700 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 3-(1,3-thiazol-2-yl)oxan-4-ol |
| SMILES | OC1CCOCC1c1nccs1 |
| InChI | InChI=1S/C8H11NO2S/c10-7-1-3-11-5-6(7)8-9-2-4-12-8/h2,4,6-7,10H,1,3,5H2 |
| InChIKey | VUEUSQSWZGVKAL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,3-thiazol-2-yl)oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-thiazol-2-yl)oxan-4-ol?
The IUPAC name of 3-(1,3-thiazol-2-yl)oxan-4-ol (CID 67258700) is 3-(1,3-thiazol-2-yl)oxan-4-ol.
What is the SMILES notation for 3-(1,3-thiazol-2-yl)oxan-4-ol?
The canonical SMILES for 3-(1,3-thiazol-2-yl)oxan-4-ol is OC1CCOCC1c1nccs1.
What is the InChIKey of 3-(1,3-thiazol-2-yl)oxan-4-ol?
The InChIKey is VUEUSQSWZGVKAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S/c10-7-1-3-11-5-6(7)8-9-2-4-12-8/h2,4,6-7,10H,1,3,5H2.
What are the key properties of 3-(1,3-thiazol-2-yl)oxan-4-ol?
3-(1,3-thiazol-2-yl)oxan-4-ol has a molecular weight of 185.25 g/mol, XLogP of 1.01, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-thiazol-2-yl)oxan-4-ol is sourced from PubChem (CID 67258700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).