About pyrrolo[3,4-e]indazole
pyrrolo[3,4-e]indazole (PubChem CID 67258838) has the molecular formula C9H5N3
and a molecular weight of 155.16 g/mol. Its IUPAC name is pyrrolo[3,4-e]indazole.
Molecular Properties
| Compound Name | pyrrolo[3,4-e]indazole |
| PubChem CID | 67258838 |
| Molecular Formula | C9H5N3 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | pyrrolo[3,4-e]indazole |
| SMILES | C1=NC=c2ccc3c(c21)C=NN=3 |
| InChI | InChI=1S/C9H5N3/c1-2-9-8(5-11-12-9)7-4-10-3-6(1)7/h1-5H |
| InChIKey | DHUYHYJHBWMELN-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolo[3,4-e]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[3,4-e]indazole?
The IUPAC name of pyrrolo[3,4-e]indazole (CID 67258838) is pyrrolo[3,4-e]indazole.
What is the SMILES notation for pyrrolo[3,4-e]indazole?
The canonical SMILES for pyrrolo[3,4-e]indazole is C1=NC=c2ccc3c(c21)C=NN=3.
What is the InChIKey of pyrrolo[3,4-e]indazole?
The InChIKey is DHUYHYJHBWMELN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N3/c1-2-9-8(5-11-12-9)7-4-10-3-6(1)7/h1-5H.
What are the key properties of pyrrolo[3,4-e]indazole?
pyrrolo[3,4-e]indazole has a molecular weight of 155.16 g/mol, XLogP of -0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[3,4-e]indazole is sourced from PubChem (CID 67258838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).