About tert-butyl N-[(2-bromo-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)methyl]-N-methylcarbamate
tert-butyl N-[(2-bromo-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)methyl]-N-methylcarbamate (PubChem CID 67258945) has the molecular formula C14H20BrNO2S
and a molecular weight of 346.29 g/mol. Its IUPAC name is tert-butyl N-[(2-bromo-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)methyl]-N-methylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2-bromo-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)methyl]-N-methylcarbamate |
| PubChem CID | 67258945 |
| Molecular Formula | C14H20BrNO2S |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | tert-butyl N-[(2-bromo-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)methyl]-N-methylcarbamate |
| SMILES | CN(CC1CCc2sc(Br)cc21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H20BrNO2S/c1-14(2,3)18-13(17)16(4)8-9-5-6-11-10(9)7-12(15)19-11/h7,9H,5-6,8H2,1-4H3 |
| InChIKey | ULVOVDNVCHSKIY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-[(2-bromo-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)methyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2-bromo-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)methyl]-N-methylcarbamate?
The IUPAC name of tert-butyl N-[(2-bromo-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)methyl]-N-methylcarbamate (CID 67258945) is tert-butyl N-[(2-bromo-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)methyl]-N-methylcarbamate.
What is the SMILES notation for tert-butyl N-[(2-bromo-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)methyl]-N-methylcarbamate?
The canonical SMILES for tert-butyl N-[(2-bromo-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)methyl]-N-methylcarbamate is CN(CC1CCc2sc(Br)cc21)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(2-bromo-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)methyl]-N-methylcarbamate?
The InChIKey is ULVOVDNVCHSKIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20BrNO2S/c1-14(2,3)18-13(17)16(4)8-9-5-6-11-10(9)7-12(15)19-11/h7,9H,5-6,8H2,1-4H3.
What are the key properties of tert-butyl N-[(2-bromo-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)methyl]-N-methylcarbamate?
tert-butyl N-[(2-bromo-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)methyl]-N-methylcarbamate has a molecular weight of 346.29 g/mol, XLogP of 4.41, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2-bromo-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)methyl]-N-methylcarbamate is sourced from PubChem (CID 67258945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).