C29H24N2O2 — CID 67259157
1,2-dinaphthalen-2-yl-4,4-bis(prop-2-enyl)pyrazolidine-3,5-dione (PubChem CID 67259157) has the molecular formula C29H24N2O2 and a molecular weight of 432.52 g/mol. Its IUPAC name is 1,2-dinaphthalen-2-yl-4,4-bis(prop-2-enyl)pyrazolidine-3,5-dione.
| Compound Name | 1,2-dinaphthalen-2-yl-4,4-bis(prop-2-enyl)pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 67259157 |
| Molecular Formula | C29H24N2O2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 1,2-dinaphthalen-2-yl-4,4-bis(prop-2-enyl)pyrazolidine-3,5-dione |
| SMILES | C=CCC1(CC=C)C(=O)N(c2ccc3ccccc3c2)N(c2ccc3ccccc3c2)C1=O |
| InChI | InChI=1S/C29H24N2O2/c1-3-17-29(18-4-2)27(32)30(25-15-13-21-9-5-7-11-23(21)19-25)31(28(29)33)26-16-14-22-10-6-8-12-24(22)20-26/h3-16,19-20H,1-2,17-18H2 |
| InChIKey | YHHZNMMACJVJAM-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|