About 2,3,3a,7a-tetrahydro-1,3-benzothiazole-2,6-diamine
2,3,3a,7a-tetrahydro-1,3-benzothiazole-2,6-diamine (PubChem CID 67259186) has the molecular formula C7H11N3S
and a molecular weight of 169.25 g/mol. Its IUPAC name is 2,3,3a,7a-tetrahydro-1,3-benzothiazole-2,6-diamine.
Analyze 2,3,3a,7a-tetrahydro-1,3-benzothiazole-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,3a,7a-tetrahydro-1,3-benzothiazole-2,6-diamine?
The IUPAC name of 2,3,3a,7a-tetrahydro-1,3-benzothiazole-2,6-diamine (CID 67259186) is 2,3,3a,7a-tetrahydro-1,3-benzothiazole-2,6-diamine.
What is the SMILES notation for 2,3,3a,7a-tetrahydro-1,3-benzothiazole-2,6-diamine?
The canonical SMILES for 2,3,3a,7a-tetrahydro-1,3-benzothiazole-2,6-diamine is NC1=CC2SC(N)NC2C=C1.
What is the InChIKey of 2,3,3a,7a-tetrahydro-1,3-benzothiazole-2,6-diamine?
The InChIKey is VBSMZAHRAXKQSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3S/c8-4-1-2-5-6(3-4)11-7(9)10-5/h1-3,5-7,10H,8-9H2.
What are the key properties of 2,3,3a,7a-tetrahydro-1,3-benzothiazole-2,6-diamine?
2,3,3a,7a-tetrahydro-1,3-benzothiazole-2,6-diamine has a molecular weight of 169.25 g/mol, XLogP of -0.29, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,3a,7a-tetrahydro-1,3-benzothiazole-2,6-diamine is sourced from PubChem (CID 67259186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).