About 14-methylbicyclo[9.4.0]pentadeca-1(11),6-dien-12-one
14-methylbicyclo[9.4.0]pentadeca-1(11),6-dien-12-one (PubChem CID 67259243) has the molecular formula C16H24O
and a molecular weight of 232.37 g/mol. Its IUPAC name is 14-methylbicyclo[9.4.0]pentadeca-1(11),6-dien-12-one.
Molecular Properties
| Compound Name | 14-methylbicyclo[9.4.0]pentadeca-1(11),6-dien-12-one |
| PubChem CID | 67259243 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 14-methylbicyclo[9.4.0]pentadeca-1(11),6-dien-12-one |
| SMILES | CC1CC(=O)C2=C(CCCCC=CCCC2)C1 |
| InChI | InChI=1S/C16H24O/c1-13-11-14-9-7-5-3-2-4-6-8-10-15(14)16(17)12-13/h2,4,13H,3,5-12H2,1H3 |
| InChIKey | MVTLRRDJZKLXNN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 14-methylbicyclo[9.4.0]pentadeca-1(11),6-dien-12-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 14-methylbicyclo[9.4.0]pentadeca-1(11),6-dien-12-one?
The IUPAC name of 14-methylbicyclo[9.4.0]pentadeca-1(11),6-dien-12-one (CID 67259243) is 14-methylbicyclo[9.4.0]pentadeca-1(11),6-dien-12-one.
What is the SMILES notation for 14-methylbicyclo[9.4.0]pentadeca-1(11),6-dien-12-one?
The canonical SMILES for 14-methylbicyclo[9.4.0]pentadeca-1(11),6-dien-12-one is CC1CC(=O)C2=C(CCCCC=CCCC2)C1.
What is the InChIKey of 14-methylbicyclo[9.4.0]pentadeca-1(11),6-dien-12-one?
The InChIKey is MVTLRRDJZKLXNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O/c1-13-11-14-9-7-5-3-2-4-6-8-10-15(14)16(17)12-13/h2,4,13H,3,5-12H2,1H3.
What are the key properties of 14-methylbicyclo[9.4.0]pentadeca-1(11),6-dien-12-one?
14-methylbicyclo[9.4.0]pentadeca-1(11),6-dien-12-one has a molecular weight of 232.37 g/mol, XLogP of 4.58, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 14-methylbicyclo[9.4.0]pentadeca-1(11),6-dien-12-one is sourced from PubChem (CID 67259243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).