1-(1,3-thiazol-2-yl)bicyclo[3.1.0]hexane-6-carboxylic acid

C10H11NO2S — CID 67259291

IUPAC1-(1,3-thiazol-2-yl)bicyclo[3.1.0]hexane-6-carboxylic acid
SMILESO=C(O)C1C2CCCC21c1nccs1
InChIInChI=1S/C10H11NO2S/c12-8(13)7-6-2-1-3-10(6,7)9-11-4-5-14-9/h4-7H,1-3H2,(H,12,13)
InChIKeyUPSMCODAXQTQJG-UHFFFAOYSA-N
MW209.27 g/mol
LogP1.90
Rot. Bonds2

About 1-(1,3-thiazol-2-yl)bicyclo[3.1.0]hexane-6-carboxylic acid

1-(1,3-thiazol-2-yl)bicyclo[3.1.0]hexane-6-carboxylic acid (PubChem CID 67259291) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-yl)bicyclo[3.1.0]hexane-6-carboxylic acid.

Molecular Properties

Compound Name1-(1,3-thiazol-2-yl)bicyclo[3.1.0]hexane-6-carboxylic acid
PubChem CID67259291
Molecular FormulaC10H11NO2S
Molecular Weight209.27 g/mol
Exact Mass209.05
IUPAC Name1-(1,3-thiazol-2-yl)bicyclo[3.1.0]hexane-6-carboxylic acid
SMILESO=C(O)C1C2CCCC21c1nccs1
InChIInChI=1S/C10H11NO2S/c12-8(13)7-6-2-1-3-10(6,7)9-11-4-5-14-9/h4-7H,1-3H2,(H,12,13)
InChIKeyUPSMCODAXQTQJG-UHFFFAOYSA-N
XLogP1.90
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.27
LogP ≤ 51.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-(1,3-thiazol-2-yl)bicyclo[3.1.0]hexane-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(1,3-thiazol-2-yl)bicyclo[3.1.0]hexane-6-carboxylic acid?
The IUPAC name of 1-(1,3-thiazol-2-yl)bicyclo[3.1.0]hexane-6-carboxylic acid (CID 67259291) is 1-(1,3-thiazol-2-yl)bicyclo[3.1.0]hexane-6-carboxylic acid.
What is the SMILES notation for 1-(1,3-thiazol-2-yl)bicyclo[3.1.0]hexane-6-carboxylic acid?
The canonical SMILES for 1-(1,3-thiazol-2-yl)bicyclo[3.1.0]hexane-6-carboxylic acid is O=C(O)C1C2CCCC21c1nccs1.
What is the InChIKey of 1-(1,3-thiazol-2-yl)bicyclo[3.1.0]hexane-6-carboxylic acid?
The InChIKey is UPSMCODAXQTQJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2S/c12-8(13)7-6-2-1-3-10(6,7)9-11-4-5-14-9/h4-7H,1-3H2,(H,12,13).
What are the key properties of 1-(1,3-thiazol-2-yl)bicyclo[3.1.0]hexane-6-carboxylic acid?
1-(1,3-thiazol-2-yl)bicyclo[3.1.0]hexane-6-carboxylic acid has a molecular weight of 209.27 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-thiazol-2-yl)bicyclo[3.1.0]hexane-6-carboxylic acid is sourced from PubChem (CID 67259291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).