C12H16N2O3 — CID 67259344
1-ethyl-5,5-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione (PubChem CID 67259344) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1-ethyl-5,5-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-ethyl-5,5-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 67259344 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-ethyl-5,5-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCC1(CC=C)C(=O)NC(=O)N(CC)C1=O |
| InChI | InChI=1S/C12H16N2O3/c1-4-7-12(8-5-2)9(15)13-11(17)14(6-3)10(12)16/h4-5H,1-2,6-8H2,3H3,(H,13,15,17) |
| InChIKey | LTYGGCOJNCKKDK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|